C11H13ClN6O2 — CID 4771010
4-[(4-chloro-1-ethylpyrazole-5-carbonyl)amino]-1-methylpyrazole-5-carboxamide (PubChem CID 4771010) has the molecular formula C11H13ClN6O2 and a molecular weight of 296.72 g/mol. Its IUPAC name is 4-[(4-chloro-1-ethylpyrazole-5-carbonyl)amino]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[(4-chloro-1-ethylpyrazole-5-carbonyl)amino]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4771010 |
| Molecular Formula | C11H13ClN6O2 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[(4-chloro-1-ethylpyrazole-5-carbonyl)amino]-1-methylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(Cl)c1C(=O)Nc1cnn(C)c1C(N)=O |
| InChI | InChI=1S/C11H13ClN6O2/c1-3-18-8(6(12)4-15-18)11(20)16-7-5-14-17(2)9(7)10(13)19/h4-5H,3H2,1-2H3,(H2,13,19)(H,16,20) |
| InChIKey | ZUZSPHIYOUMIDP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |