C12H10Cl3N3O — CID 841895
4-chloro-N-(2,3-dichlorophenyl)-1-ethylpyrazole-5-carboxamide (PubChem CID 841895) has the molecular formula C12H10Cl3N3O and a molecular weight of 318.59 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dichlorophenyl)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(2,3-dichlorophenyl)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 841895 |
| Molecular Formula | C12H10Cl3N3O |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-chloro-N-(2,3-dichlorophenyl)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(Cl)c1C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl3N3O/c1-2-18-11(8(14)6-16-18)12(19)17-9-5-3-4-7(13)10(9)15/h3-6H,2H2,1H3,(H,17,19) |
| InChIKey | NEOOEFZWGUFVFI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |