C11H14N6O2 — CID 4772781
1-ethyl-4-[(2-methylpyrazole-3-carbonyl)amino]pyrazole-5-carboxamide (PubChem CID 4772781) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-ethyl-4-[(2-methylpyrazole-3-carbonyl)amino]pyrazole-5-carboxamide.
| Compound Name | 1-ethyl-4-[(2-methylpyrazole-3-carbonyl)amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4772781 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-ethyl-4-[(2-methylpyrazole-3-carbonyl)amino]pyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=O)c2ccnn2C)c1C(N)=O |
| InChI | InChI=1S/C11H14N6O2/c1-3-17-9(10(12)18)7(6-14-17)15-11(19)8-4-5-13-16(8)2/h4-6H,3H2,1-2H3,(H2,12,18)(H,15,19) |
| InChIKey | BPJNOEYJLXRMSB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |