C14H13ClN4O3S — CID 1105438
methyl 4-[(4-chloro-1-methylpyrazole-5-carbonyl)carbamothioylamino]benzoate (PubChem CID 1105438) has the molecular formula C14H13ClN4O3S and a molecular weight of 352.80 g/mol. Its IUPAC name is methyl 4-[(4-chloro-1-methylpyrazole-5-carbonyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[(4-chloro-1-methylpyrazole-5-carbonyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 1105438 |
| Molecular Formula | C14H13ClN4O3S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | methyl 4-[(4-chloro-1-methylpyrazole-5-carbonyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)c2c(Cl)cnn2C)cc1 |
| InChI | InChI=1S/C14H13ClN4O3S/c1-19-11(10(15)7-16-19)12(20)18-14(23)17-9-5-3-8(4-6-9)13(21)22-2/h3-7H,1-2H3,(H2,17,18,20,23) |
| InChIKey | PTDQBEDISDZCLM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|