C18H18N2O3S — CID 918694
methyl 4-[(3,5-dimethylbenzoyl)carbamothioylamino]benzoate (PubChem CID 918694) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 4-[(3,5-dimethylbenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[(3,5-dimethylbenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 918694 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methyl 4-[(3,5-dimethylbenzoyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-11-8-12(2)10-14(9-11)16(21)20-18(24)19-15-6-4-13(5-7-15)17(22)23-3/h4-10H,1-3H3,(H2,19,20,21,24) |
| InChIKey | QUZDWACBIDZUAW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|