C20H21N3O5S — CID 17218528
methyl 4-[[4-(2-methoxyethylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17218528) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is methyl 4-[[4-(2-methoxyethylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[4-(2-methoxyethylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17218528 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 4-[[4-(2-methoxyethylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COCCNC(=O)c1ccc(NC(=S)NC(=O)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-27-12-11-21-17(24)13-7-9-16(10-8-13)22-20(29)23-18(25)14-3-5-15(6-4-14)19(26)28-2/h3-10H,11-12H2,1-2H3,(H,21,24)(H2,22,23,25,29) |
| InChIKey | IVGBQRAITDIART-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|