C15H12ClN3O3S — CID 54788163
methyl 4-[(6-chloro-3-pyridinyl)carbamothioylcarbamoyl]benzoate (PubChem CID 54788163) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is methyl 4-[(6-chloro-3-pyridinyl)carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[(6-chloro-3-pyridinyl)carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 54788163 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | methyl 4-[(6-chloro-3-pyridinyl)carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)Nc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C15H12ClN3O3S/c1-22-14(21)10-4-2-9(3-5-10)13(20)19-15(23)18-11-6-7-12(16)17-8-11/h2-8H,1H3,(H2,18,19,20,23) |
| InChIKey | QKDHMUWBDJEESX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|