C18H20ClN3O2S — CID 54788165
N-[(6-chloro-3-pyridinyl)carbamothioyl]-4-pentoxybenzamide (PubChem CID 54788165) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)carbamothioyl]-4-pentoxybenzamide.
| Compound Name | N-[(6-chloro-3-pyridinyl)carbamothioyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 54788165 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)carbamothioyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C18H20ClN3O2S/c1-2-3-4-11-24-15-8-5-13(6-9-15)17(23)22-18(25)21-14-7-10-16(19)20-12-14/h5-10,12H,2-4,11H2,1H3,(H2,21,22,23,25) |
| InChIKey | GVKUYUAIYARVSG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|