C12H9Cl2N5O4S — CID 3117880
4-chloro-N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-5-carboxamide (PubChem CID 3117880) has the molecular formula C12H9Cl2N5O4S and a molecular weight of 390.21 g/mol. Its IUPAC name is 4-chloro-N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3117880 |
| Molecular Formula | C12H9Cl2N5O4S |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 4-chloro-N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(Cl)c1C(=O)NC(=S)Nc1cc([N+](=O)[O-])cc(Cl)c1O |
| InChI | InChI=1S/C12H9Cl2N5O4S/c1-18-9(7(14)4-15-18)11(21)17-12(24)16-8-3-5(19(22)23)2-6(13)10(8)20/h2-4,20H,1H3,(H2,16,17,21,24) |
| InChIKey | CFOLYGCCPITHGH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|