C12H10ClN5O4S — CID 3421067
N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-3-carboxamide (PubChem CID 3421067) has the molecular formula C12H10ClN5O4S and a molecular weight of 355.76 g/mol. Its IUPAC name is N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 3421067 |
| Molecular Formula | C12H10ClN5O4S |
| Molecular Weight | 355.76 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NC(=S)Nc2cc([N+](=O)[O-])cc(Cl)c2O)n1 |
| InChI | InChI=1S/C12H10ClN5O4S/c1-17-3-2-8(16-17)11(20)15-12(23)14-9-5-6(18(21)22)4-7(13)10(9)19/h2-5,19H,1H3,(H2,14,15,20,23) |
| InChIKey | BCWYVFVVZGYTRP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|