C22H18ClN7O5 — CID 19272676
N-[4-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 19272676) has the molecular formula C22H18ClN7O5 and a molecular weight of 495.88 g/mol. Its IUPAC name is N-[4-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19272676 |
| Molecular Formula | C22H18ClN7O5 |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[4-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccc(NC(=O)c3ccn(COc4ccc([N+](=O)[O-])cc4Cl)n3)cc2)n1 |
| InChI | InChI=1S/C22H18ClN7O5/c1-28-10-8-18(26-28)21(31)24-14-2-4-15(5-3-14)25-22(32)19-9-11-29(27-19)13-35-20-7-6-16(30(33)34)12-17(20)23/h2-12H,13H2,1H3,(H,24,31)(H,25,32) |
| InChIKey | VBMQFUWQAHEVEY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 146.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|