C14H15ClN4O5 — CID 19272652
1-[(2-chloro-4-nitrophenoxy)methyl]-N-(2-methoxyethyl)pyrazole-3-carboxamide (PubChem CID 19272652) has the molecular formula C14H15ClN4O5 and a molecular weight of 354.75 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrophenoxy)methyl]-N-(2-methoxyethyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-(2-methoxyethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19272652 |
| Molecular Formula | C14H15ClN4O5 |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-(2-methoxyethyl)pyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1ccn(COc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C14H15ClN4O5/c1-23-7-5-16-14(20)12-4-6-18(17-12)9-24-13-3-2-10(19(21)22)8-11(13)15/h2-4,6,8H,5,7,9H2,1H3,(H,16,20) |
| InChIKey | IBYYTFRBHQFVJT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|