C23H21ClN6O4 — CID 19276749
1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19276749) has the molecular formula C23H21ClN6O4 and a molecular weight of 480.91 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276749 |
| Molecular Formula | C23H21ClN6O4 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)c1ccn(COc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C23H21ClN6O4/c1-15-19(16(2)29(26-15)17-6-4-3-5-7-17)13-25-23(31)21-10-11-28(27-21)14-34-22-9-8-18(30(32)33)12-20(22)24/h3-12H,13-14H2,1-2H3,(H,25,31) |
| InChIKey | ALURTEXENVAJBU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|