C20H23ClN6O4 — CID 19278862
1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methylpyrazole-3-carboxamide (PubChem CID 19278862) has the molecular formula C20H23ClN6O4 and a molecular weight of 446.90 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methylpyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19278862 |
| Molecular Formula | C20H23ClN6O4 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)c(CN(C)C(=O)c2ccn(COc3ccc([N+](=O)[O-])cc3Cl)n2)c1C |
| InChI | InChI=1S/C20H23ClN6O4/c1-5-26-14(3)16(13(2)22-26)11-24(4)20(28)18-8-9-25(23-18)12-31-19-7-6-15(27(29)30)10-17(19)21/h6-10H,5,11-12H2,1-4H3 |
| InChIKey | HOXQYQIHIIMLFZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|