C17H17ClN6O4 — CID 19276748
1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19276748) has the molecular formula C17H17ClN6O4 and a molecular weight of 404.81 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276748 |
| Molecular Formula | C17H17ClN6O4 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1c(CNC(=O)c2ccn(COc3ccc([N+](=O)[O-])cc3Cl)n2)cnn1C |
| InChI | InChI=1S/C17H17ClN6O4/c1-11-12(9-20-22(11)2)8-19-17(25)15-5-6-23(21-15)10-28-16-4-3-13(24(26)27)7-14(16)18/h3-7,9H,8,10H2,1-2H3,(H,19,25) |
| InChIKey | ULFUFFMZFMRPST-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|