C11H10ClN3O2 — CID 103119634
N-(4-chloro-3-hydroxyphenyl)-1-methylpyrazole-3-carboxamide (PubChem CID 103119634) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is N-(4-chloro-3-hydroxyphenyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-chloro-3-hydroxyphenyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103119634 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | N-(4-chloro-3-hydroxyphenyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccc(Cl)c(O)c2)n1 |
| InChI | InChI=1S/C11H10ClN3O2/c1-15-5-4-9(14-15)11(17)13-7-2-3-8(12)10(16)6-7/h2-6,16H,1H3,(H,13,17) |
| InChIKey | BMXIUBGLZGIVCD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |