C11H9BrClN3O — CID 103824695
N-(4-bromo-3-chlorophenyl)-1-methylpyrazole-3-carboxamide (PubChem CID 103824695) has the molecular formula C11H9BrClN3O and a molecular weight of 314.57 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103824695 |
| Molecular Formula | C11H9BrClN3O |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccc(Br)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H9BrClN3O/c1-16-5-4-10(15-16)11(17)14-7-2-3-8(12)9(13)6-7/h2-6H,1H3,(H,14,17) |
| InChIKey | FREFMVKRJJCNRC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |