C17H17ClN6O2 — CID 19263479
4-chloro-1-ethyl-N-[4-[(1-methylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide (PubChem CID 19263479) has the molecular formula C17H17ClN6O2 and a molecular weight of 372.82 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-[4-[(1-methylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-[4-[(1-methylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19263479 |
| Molecular Formula | C17H17ClN6O2 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-chloro-1-ethyl-N-[4-[(1-methylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Cl)c(C(=O)Nc2ccc(NC(=O)c3ccn(C)n3)cc2)n1 |
| InChI | InChI=1S/C17H17ClN6O2/c1-3-24-10-13(18)15(22-24)17(26)20-12-6-4-11(5-7-12)19-16(25)14-8-9-23(2)21-14/h4-10H,3H2,1-2H3,(H,19,25)(H,20,26) |
| InChIKey | VNLCESIZMSEHOE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |