C12H10N6O6 — CID 135933657
N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide (PubChem CID 135933657) has the molecular formula C12H10N6O6 and a molecular weight of 334.25 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135933657 |
| Molecular Formula | C12H10N6O6 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)N/N=C\c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)n1 |
| InChI | InChI=1S/C12H10N6O6/c1-16-3-2-9(15-16)12(20)14-13-6-7-4-8(17(21)22)5-10(11(7)19)18(23)24/h2-6,19H,1H3,(H,14,20)/b13-6- |
| InChIKey | NPFRHZBIRAMFKP-MLPAPPSSSA-N |
| XLogP | 0.71 |
| TPSA | 165.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|