C13H12BrF2N3O3 — CID 19262883
4-bromo-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 19262883) has the molecular formula C13H12BrF2N3O3 and a molecular weight of 376.16 g/mol. Its IUPAC name is 4-bromo-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262883 |
| Molecular Formula | C13H12BrF2N3O3 |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 4-bromo-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2nn(C)cc2Br)ccc1OC(F)F |
| InChI | InChI=1S/C13H12BrF2N3O3/c1-19-6-8(14)11(18-19)12(20)17-7-3-4-9(22-13(15)16)10(5-7)21-2/h3-6,13H,1-2H3,(H,17,20) |
| InChIKey | ORSZXQSLAJNACW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |