C16H13F2N3O3 — CID 19513943
N-[2-(difluoromethoxy)-4-methylphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 19513943) has the molecular formula C16H13F2N3O3 and a molecular weight of 333.29 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-methylphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)-4-methylphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19513943 |
| Molecular Formula | C16H13F2N3O3 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-methylphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccco3)[nH]n2)c(OC(F)F)c1 |
| InChI | InChI=1S/C16H13F2N3O3/c1-9-4-5-10(14(7-9)24-16(17)18)19-15(22)12-8-11(20-21-12)13-3-2-6-23-13/h2-8,16H,1H3,(H,19,22)(H,20,21) |
| InChIKey | YMPHUIKQPWZTLX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |