C16H13FN4O3 — CID 87045713
N-(5-carbamoyl-3-fluoro-2-methylphenyl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 87045713) has the molecular formula C16H13FN4O3 and a molecular weight of 328.30 g/mol. Its IUPAC name is N-(5-carbamoyl-3-fluoro-2-methylphenyl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-(5-carbamoyl-3-fluoro-2-methylphenyl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 87045713 |
| Molecular Formula | C16H13FN4O3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(5-carbamoyl-3-fluoro-2-methylphenyl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C16H13FN4O3/c1-8-10(17)5-9(15(18)22)6-11(8)19-16(23)13-7-12(20-21-13)14-3-2-4-24-14/h2-7H,1H3,(H2,18,22)(H,19,23)(H,20,21) |
| InChIKey | MHYNXRGSECTDDO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |