C19H14F4N4O5 — CID 19279984
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19279984) has the molecular formula C19H14F4N4O5 and a molecular weight of 454.34 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19279984 |
| Molecular Formula | C19H14F4N4O5 |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1)c1ccn(COc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C19H14F4N4O5/c20-11-1-2-17(15(21)5-11)32-10-26-4-3-16(25-26)19(28)24-12-6-13(27(29)30)8-14(7-12)31-9-18(22)23/h1-8,18H,9-10H2,(H,24,28) |
| InChIKey | RIZMYZIGTYVQDS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|