C26H22FN5O7 — CID 19280562
1-[(5-fluoro-2-nitrophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 19280562) has the molecular formula C26H22FN5O7 and a molecular weight of 535.49 g/mol. Its IUPAC name is 1-[(5-fluoro-2-nitrophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(5-fluoro-2-nitrophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19280562 |
| Molecular Formula | C26H22FN5O7 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 1-[(5-fluoro-2-nitrophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)c3ccn(COc4cc(F)ccc4[N+](=O)[O-])n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H22FN5O7/c1-15-8-16(2)17(3)24(9-15)39-21-12-19(11-20(13-21)31(34)35)28-26(33)22-6-7-30(29-22)14-38-25-10-18(27)4-5-23(25)32(36)37/h4-13H,14H2,1-3H3,(H,28,33) |
| InChIKey | NNIUCOKUGGWARG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|