C25H20FN5O7 — CID 19276883
N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19276883) has the molecular formula C25H20FN5O7 and a molecular weight of 521.46 g/mol. Its IUPAC name is N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276883 |
| Molecular Formula | C25H20FN5O7 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(C)c(Oc2cc(NC(=O)c3ccn(COc4cc(F)ccc4[N+](=O)[O-])n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C25H20FN5O7/c1-15-3-4-16(2)23(9-15)38-20-12-18(11-19(13-20)30(33)34)27-25(32)21-7-8-29(28-21)14-37-24-10-17(26)5-6-22(24)31(35)36/h3-13H,14H2,1-2H3,(H,27,32) |
| InChIKey | IINPXRMUYHHPCM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|