C18H15N5O7 — CID 19274018
N-(3-methoxy-5-nitrophenyl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19274018) has the molecular formula C18H15N5O7 and a molecular weight of 413.35 g/mol. Its IUPAC name is N-(3-methoxy-5-nitrophenyl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(3-methoxy-5-nitrophenyl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19274018 |
| Molecular Formula | C18H15N5O7 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-(3-methoxy-5-nitrophenyl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccn(COc3ccccc3[N+](=O)[O-])n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N5O7/c1-29-14-9-12(8-13(10-14)22(25)26)19-18(24)15-6-7-21(20-15)11-30-17-5-3-2-4-16(17)23(27)28/h2-10H,11H2,1H3,(H,19,24) |
| InChIKey | SGKSCFUGKFNRBG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|