C23H19N5O6 — CID 19273282
1-[(4-methoxyphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)pyrazole-3-carboxamide (PubChem CID 19273282) has the molecular formula C23H19N5O6 and a molecular weight of 461.43 g/mol. Its IUPAC name is 1-[(4-methoxyphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(4-methoxyphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273282 |
| Molecular Formula | C23H19N5O6 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-[(4-methoxyphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(OCn2ccc(C(=O)Nc3cc(Oc4cccnc4)cc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C23H19N5O6/c1-32-18-4-6-19(7-5-18)33-15-27-10-8-22(26-27)23(29)25-16-11-17(28(30)31)13-21(12-16)34-20-3-2-9-24-14-20/h2-14H,15H2,1H3,(H,25,29) |
| InChIKey | AWFBBOIWEPLNLR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|