C24H19BrN4O5 — CID 19272375
1-[(4-bromophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide (PubChem CID 19272375) has the molecular formula C24H19BrN4O5 and a molecular weight of 523.34 g/mol. Its IUPAC name is 1-[(4-bromophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19272375 |
| Molecular Formula | C24H19BrN4O5 |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | 1-[(4-bromophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(Oc2cc(NC(=O)c3ccn(COc4ccc(Br)cc4)n3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H19BrN4O5/c1-16-2-6-21(7-3-16)34-22-13-18(12-19(14-22)29(31)32)26-24(30)23-10-11-28(27-23)15-33-20-8-4-17(25)5-9-20/h2-14H,15H2,1H3,(H,26,30) |
| InChIKey | OUKKVBOFHGKCNN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|