C26H21F3N4O7 — CID 19277290
1-[(2,6-dimethoxyphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide (PubChem CID 19277290) has the molecular formula C26H21F3N4O7 and a molecular weight of 558.47 g/mol. Its IUPAC name is 1-[(2,6-dimethoxyphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2,6-dimethoxyphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19277290 |
| Molecular Formula | C26H21F3N4O7 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 1-[(2,6-dimethoxyphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide |
| SMILES | COc1cccc(OC)c1OCn1ccc(C(=O)Nc2cc(Oc3cccc(C(F)(F)F)c3)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C26H21F3N4O7/c1-37-22-7-4-8-23(38-2)24(22)39-15-32-10-9-21(31-32)25(34)30-17-12-18(33(35)36)14-20(13-17)40-19-6-3-5-16(11-19)26(27,28)29/h3-14H,15H2,1-2H3,(H,30,34) |
| InChIKey | LLOMOWDJXFTBHB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|