C26H22Cl2N4O5 — CID 19269934
1-[(2,6-dichlorophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 19269934) has the molecular formula C26H22Cl2N4O5 and a molecular weight of 541.39 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269934 |
| Molecular Formula | C26H22Cl2N4O5 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | 1-[(2,6-dichlorophenoxy)methyl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)c3ccn(COc4c(Cl)cccc4Cl)n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H22Cl2N4O5/c1-15-9-16(2)17(3)24(10-15)37-20-12-18(11-19(13-20)32(34)35)29-26(33)23-7-8-31(30-23)14-36-25-21(27)5-4-6-22(25)28/h4-13H,14H2,1-3H3,(H,29,33) |
| InChIKey | PQVRHGFTVJXQCP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|