C15H15F2N5O7 — CID 19528262
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 19528262) has the molecular formula C15H15F2N5O7 and a molecular weight of 415.31 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19528262 |
| Molecular Formula | C15H15F2N5O7 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(C(C)C(=O)Nc2cc(OCC(F)F)cc([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F2N5O7/c1-8(20-6-12(22(26)27)15(19-20)28-2)14(23)18-9-3-10(21(24)25)5-11(4-9)29-7-13(16)17/h3-6,8,13H,7H2,1-2H3,(H,18,23) |
| InChIKey | ODRDCJPHGZHGLQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|