C22H20F2N4O5 — CID 19530353
2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]acetamide (PubChem CID 19530353) has the molecular formula C22H20F2N4O5 and a molecular weight of 458.42 g/mol. Its IUPAC name is 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]acetamide.
| Compound Name | 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 19530353 |
| Molecular Formula | C22H20F2N4O5 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]acetamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)Cn2nc(C3CC3)cc2C(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20F2N4O5/c1-32-19-4-2-3-5-20(19)33-16-9-14(8-15(10-16)28(30)31)25-21(29)12-27-18(22(23)24)11-17(26-27)13-6-7-13/h2-5,8-11,13,22H,6-7,12H2,1H3,(H,25,29) |
| InChIKey | PKHSXJLNHWNZRZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|