C13H6F7N5O5 — CID 19529942
2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 19529942) has the molecular formula C13H6F7N5O5 and a molecular weight of 445.21 g/mol. Its IUPAC name is 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19529942 |
| Molecular Formula | C13H6F7N5O5 |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H6F7N5O5/c1-3-11(24(27)28)12(25(29)30)22-23(3)2-4(26)21-10-8(16)6(14)5(13(18,19)20)7(15)9(10)17/h2H2,1H3,(H,21,26) |
| InChIKey | XHSMURDVBLLFEB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|