C6H7N5O5 — CID 171981638
2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 171981638) has the molecular formula C6H7N5O5 and a molecular weight of 229.15 g/mol. Its IUPAC name is 2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 171981638 |
| Molecular Formula | C6H7N5O5 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(N)=O |
| InChI | InChI=1S/C6H7N5O5/c1-3-5(10(13)14)6(11(15)16)8-9(3)2-4(7)12/h2H2,1H3,(H2,7,12) |
| InChIKey | KRYCZPWLLMORSO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|