C12H18N6O6 — CID 19530085
2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 19530085) has the molecular formula C12H18N6O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 19530085 |
| Molecular Formula | C12H18N6O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C12H18N6O6/c1-9-11(17(20)21)12(18(22)23)14-16(9)8-10(19)13-2-3-15-4-6-24-7-5-15/h2-8H2,1H3,(H,13,19) |
| InChIKey | QCZOOXFNZQCKOC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|