C12H18N6O5 — CID 19529994
2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 19529994) has the molecular formula C12H18N6O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 19529994 |
| Molecular Formula | C12H18N6O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(5-methyl-3,4-dinitropyrazol-1-yl)-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)NC1CCN(C)CC1 |
| InChI | InChI=1S/C12H18N6O5/c1-8-11(17(20)21)12(18(22)23)14-16(8)7-10(19)13-9-3-5-15(2)6-4-9/h9H,3-7H2,1-2H3,(H,13,19) |
| InChIKey | NUYGTMDEAICWPQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|