C12H9BrFN5O5 — CID 19529862
N-(4-bromo-2-fluorophenyl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19529862) has the molecular formula C12H9BrFN5O5 and a molecular weight of 402.14 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19529862 |
| Molecular Formula | C12H9BrFN5O5 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H9BrFN5O5/c1-6-11(18(21)22)12(19(23)24)16-17(6)5-10(20)15-9-3-2-7(13)4-8(9)14/h2-4H,5H2,1H3,(H,15,20) |
| InChIKey | GHNWFVDJUGHAIB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|