C13H19F3N4O2 — CID 19522035
2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 19522035) has the molecular formula C13H19F3N4O2 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 19522035 |
| Molecular Formula | C13H19F3N4O2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | Cc1cc(C(F)(F)F)n(CC(=O)NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C13H19F3N4O2/c1-10-8-11(13(14,15)16)20(18-10)9-12(21)17-2-3-19-4-6-22-7-5-19/h8H,2-7,9H2,1H3,(H,17,21) |
| InChIKey | JZTSWSBTSNZNDC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |