C14H21F3N4O2 — CID 19521841
2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 19521841) has the molecular formula C14H21F3N4O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 19521841 |
| Molecular Formula | C14H21F3N4O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | Cc1cc(C(F)(F)F)n(CC(=O)NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C14H21F3N4O2/c1-11-9-12(14(15,16)17)21(19-11)10-13(22)18-3-2-4-20-5-7-23-8-6-20/h9H,2-8,10H2,1H3,(H,18,22) |
| InChIKey | GEBXTHFKRACYBI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|