C15H25N5O4 — CID 34521131
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide (PubChem CID 34521131) has the molecular formula C15H25N5O4 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 34521131 |
| Molecular Formula | C15H25N5O4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide |
| SMILES | Cc1nn(CC(=O)NCC(C)(C)N2CCOCC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N5O4/c1-11-14(20(22)23)12(2)19(17-11)9-13(21)16-10-15(3,4)18-5-7-24-8-6-18/h5-10H2,1-4H3,(H,16,21) |
| InChIKey | CNDWRRVPRSFTAH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|