C7H6N4O7 — CID 171665738
3,4-dinitro-1-(2-oxopropyl)pyrazole-5-carboxylic acid (PubChem CID 171665738) has the molecular formula C7H6N4O7 and a molecular weight of 258.15 g/mol. Its IUPAC name is 3,4-dinitro-1-(2-oxopropyl)pyrazole-5-carboxylic acid.
| Compound Name | 3,4-dinitro-1-(2-oxopropyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 171665738 |
| Molecular Formula | C7H6N4O7 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 3,4-dinitro-1-(2-oxopropyl)pyrazole-5-carboxylic acid |
| SMILES | CC(=O)Cn1nc([N+](=O)[O-])c([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C7H6N4O7/c1-3(12)2-9-5(7(13)14)4(10(15)16)6(8-9)11(17)18/h2H2,1H3,(H,13,14) |
| InChIKey | SNMITBZSWUIIMQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|