C7H8N4O6 — CID 178075036
1-(4-methoxy-3,5-dinitropyrazol-1-yl)propan-2-one (PubChem CID 178075036) has the molecular formula C7H8N4O6 and a molecular weight of 244.16 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dinitropyrazol-1-yl)propan-2-one.
| Compound Name | 1-(4-methoxy-3,5-dinitropyrazol-1-yl)propan-2-one |
|---|---|
| PubChem CID | 178075036 |
| Molecular Formula | C7H8N4O6 |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-(4-methoxy-3,5-dinitropyrazol-1-yl)propan-2-one |
| SMILES | COc1c([N+](=O)[O-])nn(CC(C)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N4O6/c1-4(12)3-9-7(11(15)16)5(17-2)6(8-9)10(13)14/h3H2,1-2H3 |
| InChIKey | DGOZFADUDWSJDN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|