C5H3N4O6- — CID 7066809
2-(4,5-dinitroimidazol-1-yl)acetate (PubChem CID 7066809) has the molecular formula C5H3N4O6- and a molecular weight of 215.10 g/mol. Its IUPAC name is 2-(4,5-dinitroimidazol-1-yl)acetate.
| Compound Name | 2-(4,5-dinitroimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 7066809 |
| Molecular Formula | C5H3N4O6- |
| Molecular Weight | 215.10 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 2-(4,5-dinitroimidazol-1-yl)acetate |
| SMILES | O=C([O-])Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C5H4N4O6/c10-3(11)1-7-2-6-4(8(12)13)5(7)9(14)15/h2H,1H2,(H,10,11)/p-1 |
| InChIKey | JAFCWYHZBGGMBK-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 144.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.10 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|