About 2-(4,5-dinitroimidazol-1-yl)acetate
2-(4,5-dinitroimidazol-1-yl)acetate (PubChem CID 7066809) has the molecular formula C5H3N4O6-
and a molecular weight of 215.10 g/mol. Its IUPAC name is 2-(4,5-dinitroimidazol-1-yl)acetate.
Molecular Properties
| Compound Name | 2-(4,5-dinitroimidazol-1-yl)acetate |
| PubChem CID | 7066809 |
| Molecular Formula | C5H3N4O6- |
| Molecular Weight | 215.10 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 2-(4,5-dinitroimidazol-1-yl)acetate |
| SMILES | O=C([O-])Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C5H4N4O6/c10-3(11)1-7-2-6-4(8(12)13)5(7)9(14)15/h2H,1H2,(H,10,11)/p-1 |
| InChIKey | JAFCWYHZBGGMBK-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 144.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.10 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dinitroimidazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dinitroimidazol-1-yl)acetate?
The IUPAC name of 2-(4,5-dinitroimidazol-1-yl)acetate (CID 7066809) is 2-(4,5-dinitroimidazol-1-yl)acetate.
What is the SMILES notation for 2-(4,5-dinitroimidazol-1-yl)acetate?
The canonical SMILES for 2-(4,5-dinitroimidazol-1-yl)acetate is O=C([O-])Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 2-(4,5-dinitroimidazol-1-yl)acetate?
The InChIKey is JAFCWYHZBGGMBK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N4O6/c10-3(11)1-7-2-6-4(8(12)13)5(7)9(14)15/h2H,1H2,(H,10,11)/p-1.
What are the key properties of 2-(4,5-dinitroimidazol-1-yl)acetate?
2-(4,5-dinitroimidazol-1-yl)acetate has a molecular weight of 215.10 g/mol, XLogP of -1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dinitroimidazol-1-yl)acetate is sourced from PubChem (CID 7066809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).