C11H7ClN4O5 — CID 4979576
1-(4-chlorophenyl)-2-(4,5-dinitroimidazol-1-yl)ethanone (PubChem CID 4979576) has the molecular formula C11H7ClN4O5 and a molecular weight of 310.65 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(4,5-dinitroimidazol-1-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(4,5-dinitroimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 4979576 |
| Molecular Formula | C11H7ClN4O5 |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(4,5-dinitroimidazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H7ClN4O5/c12-8-3-1-7(2-4-8)9(17)5-14-6-13-10(15(18)19)11(14)16(20)21/h1-4,6H,5H2 |
| InChIKey | PKFDKMDIKIYPQZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 121.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|