C13H7Cl3N4O — CID 170775423
1-(4-chlorophenyl)-2-(2,6-dichloropurin-9-yl)ethanone (PubChem CID 170775423) has the molecular formula C13H7Cl3N4O and a molecular weight of 341.59 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,6-dichloropurin-9-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(2,6-dichloropurin-9-yl)ethanone |
|---|---|
| PubChem CID | 170775423 |
| Molecular Formula | C13H7Cl3N4O |
| Molecular Weight | 341.59 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,6-dichloropurin-9-yl)ethanone |
| SMILES | O=C(Cn1cnc2c(Cl)nc(Cl)nc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H7Cl3N4O/c14-8-3-1-7(2-4-8)9(21)5-20-6-17-10-11(15)18-13(16)19-12(10)20/h1-4,6H,5H2 |
| InChIKey | LEJXMKFBEMMJBQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |