C11H10ClN7O — CID 170775419
2-(2-chloro-6-hydrazinylpurin-9-yl)-1-(1H-pyrrol-2-yl)ethanone (PubChem CID 170775419) has the molecular formula C11H10ClN7O and a molecular weight of 291.70 g/mol. Its IUPAC name is 2-(2-chloro-6-hydrazinylpurin-9-yl)-1-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 2-(2-chloro-6-hydrazinylpurin-9-yl)-1-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 170775419 |
| Molecular Formula | C11H10ClN7O |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-(2-chloro-6-hydrazinylpurin-9-yl)-1-(1H-pyrrol-2-yl)ethanone |
| SMILES | NNc1nc(Cl)nc2c1ncn2CC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C11H10ClN7O/c12-11-16-9(18-13)8-10(17-11)19(5-15-8)4-7(20)6-2-1-3-14-6/h1-3,5,14H,4,13H2,(H,16,17,18) |
| InChIKey | XMMICQANCQLXJX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|