C13H16ClN5O4 — CID 10641015
dimethyl 2-[2-[2-chloro-6-(methylamino)purin-9-yl]ethyl]propanedioate (PubChem CID 10641015) has the molecular formula C13H16ClN5O4 and a molecular weight of 341.76 g/mol. Its IUPAC name is dimethyl 2-[2-[2-chloro-6-(methylamino)purin-9-yl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[2-chloro-6-(methylamino)purin-9-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 10641015 |
| Molecular Formula | C13H16ClN5O4 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | dimethyl 2-[2-[2-chloro-6-(methylamino)purin-9-yl]ethyl]propanedioate |
| SMILES | CNc1nc(Cl)nc2c1ncn2CCC(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H16ClN5O4/c1-15-9-8-10(18-13(14)17-9)19(6-16-8)5-4-7(11(20)22-2)12(21)23-3/h6-7H,4-5H2,1-3H3,(H,15,17,18) |
| InChIKey | PQGXRUIWFYBLPP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|