C13H25ClN7O7P — CID 10972542
diazanium;[2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-ethoxycarbonyloxypropyl] phosphate (PubChem CID 10972542) has the molecular formula C13H25ClN7O7P and a molecular weight of 457.81 g/mol. Its IUPAC name is diazanium;[2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-ethoxycarbonyloxypropyl] phosphate.
| Compound Name | diazanium;[2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-ethoxycarbonyloxypropyl] phosphate |
|---|---|
| PubChem CID | 10972542 |
| Molecular Formula | C13H25ClN7O7P |
| Molecular Weight | 457.81 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | diazanium;[2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-ethoxycarbonyloxypropyl] phosphate |
| SMILES | CCOC(=O)OCC(COP(=O)([O-])[O-])Cn1cnc2c(NC)nc(Cl)nc21.[NH4+].[NH4+] |
| InChI | InChI=1S/C13H19ClN5O7P.2H3N/c1-3-24-13(20)25-5-8(6-26-27(21,22)23)4-19-7-16-9-10(15-2)17-12(14)18-11(9)19;;/h7-8H,3-6H2,1-2H3,(H,15,17,18)(H2,21,22,23);2*1H3 |
| InChIKey | FAYGXDLCHYWMJE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 236.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.81 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|