C15H23N5O6 — CID 70450657
[2-[[6-ethoxy-2-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] ethyl carbonate (PubChem CID 70450657) has the molecular formula C15H23N5O6 and a molecular weight of 369.38 g/mol. Its IUPAC name is [2-[[6-ethoxy-2-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] ethyl carbonate.
| Compound Name | [2-[[6-ethoxy-2-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] ethyl carbonate |
|---|---|
| PubChem CID | 70450657 |
| Molecular Formula | C15H23N5O6 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-[[6-ethoxy-2-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] ethyl carbonate |
| SMILES | CCOC(=O)OCC(CO)OCn1cnc2c(OCC)nc(NC)nc21 |
| InChI | InChI=1S/C15H23N5O6/c1-4-23-13-11-12(18-14(16-3)19-13)20(8-17-11)9-26-10(6-21)7-25-15(22)24-5-2/h8,10,21H,4-7,9H2,1-3H3,(H,16,18,19) |
| InChIKey | YTWPAHHUJABPSH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |