C19H29N5O7 — CID 70450455
[2-[(6-aminopurin-9-yl)methoxy]-3-butoxycarbonyloxypropyl] butyl carbonate (PubChem CID 70450455) has the molecular formula C19H29N5O7 and a molecular weight of 439.47 g/mol. Its IUPAC name is [2-[(6-aminopurin-9-yl)methoxy]-3-butoxycarbonyloxypropyl] butyl carbonate.
| Compound Name | [2-[(6-aminopurin-9-yl)methoxy]-3-butoxycarbonyloxypropyl] butyl carbonate |
|---|---|
| PubChem CID | 70450455 |
| Molecular Formula | C19H29N5O7 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [2-[(6-aminopurin-9-yl)methoxy]-3-butoxycarbonyloxypropyl] butyl carbonate |
| SMILES | CCCCOC(=O)OCC(COC(=O)OCCCC)OCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C19H29N5O7/c1-3-5-7-27-18(25)29-9-14(10-30-19(26)28-8-6-4-2)31-13-24-12-23-15-16(20)21-11-22-17(15)24/h11-12,14H,3-10,13H2,1-2H3,(H2,20,21,22) |
| InChIKey | XWPGJVXQVQDKME-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|